C24H26N6O4S — CID 89178476
4-[4-[2-(3-methanimidoylphenoxy)propanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 89178476) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is 4-[4-[2-(3-methanimidoylphenoxy)propanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[4-[2-(3-methanimidoylphenoxy)propanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 89178476 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-[4-[2-(3-methanimidoylphenoxy)propanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | [H]/N=C/c1cccc(OC(C)C(=O)N2CCN(c3ccc(S(=O)(=O)Nc4ccncn4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H26N6O4S/c1-18(34-21-4-2-3-19(15-21)16-25)24(31)30-13-11-29(12-14-30)20-5-7-22(8-6-20)35(32,33)28-23-9-10-26-17-27-23/h2-10,15-18,25H,11-14H2,1H3,(H,26,27,28)/b25-16+ |
| InChIKey | ZEOQAMMFCOBDMI-PCLIKHOPSA-N |
| XLogP | 2.39 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|