C21H30N2O8 — CID 24877043
methyl 2-[4-[2-[(3aR,5S,6R,6aR)-5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethylcarbamoylamino]phenyl]acetate (PubChem CID 24877043) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 2-[4-[2-[(3aR,5S,6R,6aR)-5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethylcarbamoylamino]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-[(3aR,5S,6R,6aR)-5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethylcarbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 24877043 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | methyl 2-[4-[2-[(3aR,5S,6R,6aR)-5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethylcarbamoylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=O)NCC[C@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C(O)CO)cc1 |
| InChI | InChI=1S/C21H30N2O8/c1-21(2)30-18-14(17(15(25)11-24)29-19(18)31-21)8-9-22-20(27)23-13-6-4-12(5-7-13)10-16(26)28-3/h4-7,14-15,17-19,24-25H,8-11H2,1-3H3,(H2,22,23,27)/t14-,15?,17+,18-,19-/m1/s1 |
| InChIKey | JJVVYQCFFLNMSP-XDYXMJOBSA-N |
| XLogP | 0.76 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |