C21H23N3O3S — CID 24877246
S-[2-(4-acetamidoanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate (PubChem CID 24877246) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is S-[2-(4-acetamidoanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[2-(4-acetamidoanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 24877246 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | S-[2-(4-acetamidoanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSC(=O)N2CCCc3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-5-10-19-16(12-14)4-3-11-24(19)21(27)28-13-20(26)23-18-8-6-17(7-9-18)22-15(2)25/h5-10,12H,3-4,11,13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | VAHHSXXHUUECLO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|