C25H24N2O2S — CID 24878608
S-[2-oxo-2-(2-phenylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate (PubChem CID 24878608) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is S-[2-oxo-2-(2-phenylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[2-oxo-2-(2-phenylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 24878608 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | S-[2-oxo-2-(2-phenylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)SCC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-18-13-14-23-20(16-18)10-7-15-27(23)25(29)30-17-24(28)26-22-12-6-5-11-21(22)19-8-3-2-4-9-19/h2-6,8-9,11-14,16H,7,10,15,17H2,1H3,(H,26,28) |
| InChIKey | SAXCXTMPMZJWJF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|