C22H22N4O2S — CID 24878278
S-[2-oxo-2-(4-pyrazol-1-ylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate (PubChem CID 24878278) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is S-[2-oxo-2-(4-pyrazol-1-ylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[2-oxo-2-(4-pyrazol-1-ylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 24878278 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | S-[2-oxo-2-(4-pyrazol-1-ylanilino)ethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)SCC(=O)Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-16-5-10-20-17(14-16)4-2-12-25(20)22(28)29-15-21(27)24-18-6-8-19(9-7-18)26-13-3-11-23-26/h3,5-11,13-14H,2,4,12,15H2,1H3,(H,24,27) |
| InChIKey | OSYDLJWKOZGOFV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|