C23H27N3O3S — CID 24877472
S-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate (PubChem CID 24877472) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is S-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate.
| Compound Name | S-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 24877472 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | S-[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-methyl-3,4-dihydro-2H-quinoline-1-carbothioate |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)SCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-17-4-9-21-18(15-17)3-2-10-26(21)23(28)30-16-22(27)24-19-5-7-20(8-6-19)25-11-13-29-14-12-25/h4-9,15H,2-3,10-14,16H2,1H3,(H,24,27) |
| InChIKey | DFGJUGRAOZAYBM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|