C22H25N5O3 — CID 24881464
N'-hydroxy-N-[4-(3-phenyltriazol-4-yl)phenyl]octanediamide (PubChem CID 24881464) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N'-hydroxy-N-[4-(3-phenyltriazol-4-yl)phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-(3-phenyltriazol-4-yl)phenyl]octanediamide |
|---|---|
| PubChem CID | 24881464 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N'-hydroxy-N-[4-(3-phenyltriazol-4-yl)phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(-c2cnnn2-c2ccccc2)cc1)NO |
| InChI | InChI=1S/C22H25N5O3/c28-21(10-6-1-2-7-11-22(29)25-30)24-18-14-12-17(13-15-18)20-16-23-26-27(20)19-8-4-3-5-9-19/h3-5,8-9,12-16,30H,1-2,6-7,10-11H2,(H,24,28)(H,25,29) |
| InChIKey | OSBJPHXXKNVNGT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|