C16H26N2O2 — CID 24882128
(6R,8S,9aS)-8-methyl-6-[[(2S)-6-oxopiperidin-2-yl]methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 24882128) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (6R,8S,9aS)-8-methyl-6-[[(2S)-6-oxopiperidin-2-yl]methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6R,8S,9aS)-8-methyl-6-[[(2S)-6-oxopiperidin-2-yl]methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 24882128 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (6R,8S,9aS)-8-methyl-6-[[(2S)-6-oxopiperidin-2-yl]methyl]-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | C[C@@H]1C[C@H](C[C@@H]2CCCC(=O)N2)N2C(=O)CCC[C@H]2C1 |
| InChI | InChI=1S/C16H26N2O2/c1-11-8-13-5-3-7-16(20)18(13)14(9-11)10-12-4-2-6-15(19)17-12/h11-14H,2-10H2,1H3,(H,17,19)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | BKORLZUEHBZKFV-XDQVBPFNSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |