C10H17NO4 — CID 42640181
(6S,7R,8R,9aS)-7,8-dihydroxy-6-(hydroxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 42640181) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (6S,7R,8R,9aS)-7,8-dihydroxy-6-(hydroxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6S,7R,8R,9aS)-7,8-dihydroxy-6-(hydroxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 42640181 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (6S,7R,8R,9aS)-7,8-dihydroxy-6-(hydroxymethyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CCC[C@H]2C[C@@H](O)[C@H](O)[C@H](CO)N12 |
| InChI | InChI=1S/C10H17NO4/c12-5-7-10(15)8(13)4-6-2-1-3-9(14)11(6)7/h6-8,10,12-13,15H,1-5H2/t6-,7-,8+,10+/m0/s1 |
| InChIKey | CFFJZIAZAOOKMO-QHOPCYEYSA-N |
| XLogP | -1.15 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |