C16H26N2O2 — CID 163194231
(1R,7S,9R,11S,13S,17S)-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one (PubChem CID 163194231) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R,7S,9R,11S,13S,17S)-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one.
| Compound Name | (1R,7S,9R,11S,13S,17S)-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one |
|---|---|
| PubChem CID | 163194231 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (1R,7S,9R,11S,13S,17S)-11-methyl-17-oxido-2-aza-17-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-3-one |
| SMILES | C[C@@H]1C[C@@H]2C[C@@H]3CCCC(=O)N3[C@H]3CCC[C@@H](C1)[N@+]23[O-] |
| InChI | InChI=1S/C16H26N2O2/c1-11-8-13-5-3-6-15-17-12(4-2-7-16(17)19)10-14(9-11)18(13,15)20/h11-15H,2-10H2,1H3/t11-,12-,13-,14+,15+,18-/m0/s1 |
| InChIKey | MQPBZRMOAZLBEO-UAEUMWOFSA-N |
| XLogP | 2.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|