C11H20N2O — CID 177476822
(9aR)-8-(dimethylamino)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 177476822) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (9aR)-8-(dimethylamino)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (9aR)-8-(dimethylamino)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 177476822 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (9aR)-8-(dimethylamino)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | CN(C)C1CCN2C(=O)CCC[C@@H]2C1 |
| InChI | InChI=1S/C11H20N2O/c1-12(2)9-6-7-13-10(8-9)4-3-5-11(13)14/h9-10H,3-8H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | FFTSSUSHFGCTTR-QVDQXJPCSA-N |
| XLogP | 1.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |