C22H27N3OS — CID 24888568
N-[4,5-dimethyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-ylidene]adamantane-1-carboxamide (PubChem CID 24888568) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-ylidene]adamantane-1-carboxamide.
| Compound Name | N-[4,5-dimethyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-ylidene]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24888568 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[4,5-dimethyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-ylidene]adamantane-1-carboxamide |
| SMILES | Cc1s/c(=N/C(=O)C23CC4CC(CC(C4)C2)C3)n(Cc2cccnc2)c1C |
| InChI | InChI=1S/C22H27N3OS/c1-14-15(2)27-21(25(14)13-16-4-3-5-23-12-16)24-20(26)22-9-17-6-18(10-22)8-19(7-17)11-22/h3-5,12,17-19H,6-11,13H2,1-2H3/b24-21+ |
| InChIKey | RKUGMSSCPMRPDD-DARPEHSRSA-N |
| XLogP | 4.25 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|