C26H31N3OS — CID 24888570
N-[3-[2-(1H-indol-3-yl)ethyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]adamantane-1-carboxamide (PubChem CID 24888570) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is N-[3-[2-(1H-indol-3-yl)ethyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]adamantane-1-carboxamide.
| Compound Name | N-[3-[2-(1H-indol-3-yl)ethyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24888570 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[3-[2-(1H-indol-3-yl)ethyl]-4,5-dimethyl-1,3-thiazol-2-ylidene]adamantane-1-carboxamide |
| SMILES | Cc1s/c(=N/C(=O)C23CC4CC(CC(C4)C2)C3)n(CCc2c[nH]c3ccccc23)c1C |
| InChI | InChI=1S/C26H31N3OS/c1-16-17(2)31-25(29(16)8-7-21-15-27-23-6-4-3-5-22(21)23)28-24(30)26-12-18-9-19(13-26)11-20(10-18)14-26/h3-6,15,18-20,27H,7-14H2,1-2H3/b28-25+ |
| InChIKey | VTUTUGDAAYWWFG-AZPGRJICSA-N |
| XLogP | 5.53 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|