C25H27ClN2O4 — CID 24892549
methyl (1S,3R,3aS,6aR)-1-[4-(3-chlorophenyl)phenyl]-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 24892549) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-[4-(3-chlorophenyl)phenyl]-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-[4-(3-chlorophenyl)phenyl]-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 24892549 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-[4-(3-chlorophenyl)phenyl]-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(CC(C)C)N[C@H](c2ccc(-c3cccc(Cl)c3)cc2)[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H27ClN2O4/c1-14(2)13-25(24(31)32-4)20-19(22(29)28(3)23(20)30)21(27-25)16-10-8-15(9-11-16)17-6-5-7-18(26)12-17/h5-12,14,19-21,27H,13H2,1-4H3/t19-,20-,21-,25-/m1/s1 |
| InChIKey | JGBIVWMMJUEENB-QTDDQOEGSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|