C38H34O12 — CID 24893992
[(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-[(2E,4E,6E,8E,10E,12E,14E)-hexadeca-2,4,6,8,10,12,14-heptaenoyl]oxy-4,5-dihydroxybenzoate (PubChem CID 24893992) has the molecular formula C38H34O12 and a molecular weight of 682.68 g/mol. Its IUPAC name is [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-[(2E,4E,6E,8E,10E,12E,14E)-hexadeca-2,4,6,8,10,12,14-heptaenoyl]oxy-4,5-dihydroxybenzoate.
| Compound Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-[(2E,4E,6E,8E,10E,12E,14E)-hexadeca-2,4,6,8,10,12,14-heptaenoyl]oxy-4,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 24893992 |
| Molecular Formula | C38H34O12 |
| Molecular Weight | 682.68 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-[(2E,4E,6E,8E,10E,12E,14E)-hexadeca-2,4,6,8,10,12,14-heptaenoyl]oxy-4,5-dihydroxybenzoate |
| SMILES | C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)Oc1cc(C(=O)O[C@@H]2Cc3c(O)cc(O)cc3O[C@@H]2c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C38H34O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-34(44)48-32-19-24(18-30(43)36(32)46)38(47)50-33-22-26-27(40)20-25(39)21-31(26)49-37(33)23-16-28(41)35(45)29(42)17-23/h2-21,33,37,39-43,45-46H,22H2,1H3/b3-2+,5-4+,7-6+,9-8+,11-10+,13-12+,15-14+/t33-,37-/m1/s1 |
| InChIKey | HHZYRHUOOGPGSS-DWRCFRCYSA-N |
| XLogP | 6.35 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.68 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|