C19H25NO11 — CID 24897132
ethyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate (PubChem CID 24897132) has the molecular formula C19H25NO11 and a molecular weight of 443.41 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 24897132 |
| Molecular Formula | C19H25NO11 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)[C@@H](C#N)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H25NO11/c1-6-26-19(25)13(7-20)15-17(29-11(4)23)18(30-12(5)24)16(28-10(3)22)14(31-15)8-27-9(2)21/h13-18H,6,8H2,1-5H3/t13-,14+,15-,16+,17-,18-/m0/s1 |
| InChIKey | CVFZMVTXULZUGD-RFSXOUPVSA-N |
| XLogP | -0.19 |
| TPSA | 164.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|