C20H14F3N3O4 — CID 24899211
4-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxyoxolane-3-carboxamide (PubChem CID 24899211) has the molecular formula C20H14F3N3O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is 4-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxyoxolane-3-carboxamide.
| Compound Name | 4-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxyoxolane-3-carboxamide |
|---|---|
| PubChem CID | 24899211 |
| Molecular Formula | C20H14F3N3O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxyoxolane-3-carboxamide |
| SMILES | N#Cc1ccc(OC2COCC2(O)C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H14F3N3O4/c21-20(22,23)16-7-14(4-3-13(16)9-25)26-18(27)19(28)11-29-10-17(19)30-15-5-1-12(8-24)2-6-15/h1-7,17,28H,10-11H2,(H,26,27) |
| InChIKey | JIPLLOZJLQOHNH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |