C38H42OSn — CID 24899358
(1S,5S,6R,8S)-5-methyl-9-methylidene-5-[(E)-3-tribenzylstannylprop-2-enyl]tricyclo[6.2.2.01,6]dodec-2-en-4-one (PubChem CID 24899358) has the molecular formula C38H42OSn and a molecular weight of 633.46 g/mol. Its IUPAC name is (1S,5S,6R,8S)-5-methyl-9-methylidene-5-[(E)-3-tribenzylstannylprop-2-enyl]tricyclo[6.2.2.01,6]dodec-2-en-4-one.
| Compound Name | (1S,5S,6R,8S)-5-methyl-9-methylidene-5-[(E)-3-tribenzylstannylprop-2-enyl]tricyclo[6.2.2.01,6]dodec-2-en-4-one |
|---|---|
| PubChem CID | 24899358 |
| Molecular Formula | C38H42OSn |
| Molecular Weight | 633.46 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | (1S,5S,6R,8S)-5-methyl-9-methylidene-5-[(E)-3-tribenzylstannylprop-2-enyl]tricyclo[6.2.2.01,6]dodec-2-en-4-one |
| SMILES | C=C1C[C@@]23C=CC(=O)[C@@](C)(C/C=C/[Sn](Cc4ccccc4)(Cc4ccccc4)Cc4ccccc4)[C@@H]2C[C@@H]1CC3 |
| InChI | InChI=1S/C17H21O.3C7H7.Sn/c1-4-7-16(3)14-10-13-5-8-17(14,11-12(13)2)9-6-15(16)18;3*1-7-5-3-2-4-6-7;/h1,4,6,9,13-14H,2,5,7-8,10-11H2,3H3;3*2-6H,1H2;/t13-,14-,16-,17+;;;;/m0..../s1 |
| InChIKey | KPARNXVZUVSGGB-LMBLQNHYSA-N |
| XLogP | 8.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.46 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|