C13H16O — CID 24808693
(1R,6S,8S)-9-methylidenetricyclo[6.2.2.01,6]dodec-2-en-4-one (PubChem CID 24808693) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (1R,6S,8S)-9-methylidenetricyclo[6.2.2.01,6]dodec-2-en-4-one.
| Compound Name | (1R,6S,8S)-9-methylidenetricyclo[6.2.2.01,6]dodec-2-en-4-one |
|---|---|
| PubChem CID | 24808693 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1R,6S,8S)-9-methylidenetricyclo[6.2.2.01,6]dodec-2-en-4-one |
| SMILES | C=C1C[C@@]23C=CC(=O)C[C@@H]2C[C@@H]1CC3 |
| InChI | InChI=1S/C13H16O/c1-9-8-13-4-2-10(9)6-11(13)7-12(14)3-5-13/h3,5,10-11H,1-2,4,6-8H2/t10-,11-,13+/m0/s1 |
| InChIKey | NCEFRADPUXHRKK-GMXVVIOVSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|