C20H28O3 — CID 71546129
(2S)-2-methyl-5-[(1S,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoic acid (PubChem CID 71546129) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2S)-2-methyl-5-[(1S,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoic acid.
| Compound Name | (2S)-2-methyl-5-[(1S,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoic acid |
|---|---|
| PubChem CID | 71546129 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2S)-2-methyl-5-[(1S,5S,6R,8S)-5-methyl-9-methylidene-4-oxo-5-tricyclo[6.2.2.01,6]dodec-2-enyl]pentanoic acid |
| SMILES | C=C1C[C@@]23C=CC(=O)[C@@](C)(CCC[C@H](C)C(=O)O)[C@@H]2C[C@@H]1CC3 |
| InChI | InChI=1S/C20H28O3/c1-13(18(22)23)5-4-8-19(3)16-11-15-6-9-20(16,12-14(15)2)10-7-17(19)21/h7,10,13,15-16H,2,4-6,8-9,11-12H2,1,3H3,(H,22,23)/t13-,15-,16-,19-,20+/m0/s1 |
| InChIKey | OTSJYWFBWZYZTG-UTAYDHNUSA-N |
| XLogP | 4.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|