C15H18O3 — CID 134859367
[(10S)-9-methylidene-4-oxo-10-tricyclo[6.2.2.01,6]dodec-2-enyl] acetate (PubChem CID 134859367) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(10S)-9-methylidene-4-oxo-10-tricyclo[6.2.2.01,6]dodec-2-enyl] acetate.
| Compound Name | [(10S)-9-methylidene-4-oxo-10-tricyclo[6.2.2.01,6]dodec-2-enyl] acetate |
|---|---|
| PubChem CID | 134859367 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(10S)-9-methylidene-4-oxo-10-tricyclo[6.2.2.01,6]dodec-2-enyl] acetate |
| SMILES | C=C1C2CCC3(C=CC(=O)CC3C2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H18O3/c1-9-11-3-5-15(14(9)18-10(2)16)6-4-13(17)8-12(15)7-11/h4,6,11-12,14H,1,3,5,7-8H2,2H3/t11?,12?,14-,15?/m0/s1 |
| InChIKey | WZXXKPKRESWHRD-LGJUIHJDSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|