C17H20N2O5S — CID 24901639
(2S)-2-amino-5-oxo-5-(4-phenoxyanilino)pentane-1-sulfonic acid (PubChem CID 24901639) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2S)-2-amino-5-oxo-5-(4-phenoxyanilino)pentane-1-sulfonic acid.
| Compound Name | (2S)-2-amino-5-oxo-5-(4-phenoxyanilino)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 24901639 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-2-amino-5-oxo-5-(4-phenoxyanilino)pentane-1-sulfonic acid |
| SMILES | N[C@@H](CCC(=O)Nc1ccc(Oc2ccccc2)cc1)CS(=O)(=O)O |
| InChI | InChI=1S/C17H20N2O5S/c18-13(12-25(21,22)23)6-11-17(20)19-14-7-9-16(10-8-14)24-15-4-2-1-3-5-15/h1-5,7-10,13H,6,11-12,18H2,(H,19,20)(H,21,22,23)/t13-/m0/s1 |
| InChIKey | RBIRHCWDVXRVGI-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|