C26H18FN5O2S2 — CID 24901711
N-[[3-fluoro-4-(2-pyrimidin-2-ylthieno[3,2-b]pyridin-7-yl)oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 24901711) has the molecular formula C26H18FN5O2S2 and a molecular weight of 515.60 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-pyrimidin-2-ylthieno[3,2-b]pyridin-7-yl)oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-(2-pyrimidin-2-ylthieno[3,2-b]pyridin-7-yl)oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 24901711 |
| Molecular Formula | C26H18FN5O2S2 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-[[3-fluoro-4-(2-pyrimidin-2-ylthieno[3,2-b]pyridin-7-yl)oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4ncccn4)sc23)c(F)c1 |
| InChI | InChI=1S/C26H18FN5O2S2/c27-18-14-17(31-26(35)32-23(33)13-16-5-2-1-3-6-16)7-8-20(18)34-21-9-12-28-19-15-22(36-24(19)21)25-29-10-4-11-30-25/h1-12,14-15H,13H2,(H2,31,32,33,35) |
| InChIKey | VQGHLFSTBDILLT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|