C13H11ClN4 — CID 24904011
5-chloro-2-methyl-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 24904011) has the molecular formula C13H11ClN4 and a molecular weight of 258.71 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-methyl-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 24904011 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-chloro-2-methyl-3-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | Cc1nc2ccc(Cl)nc2n1Cc1cccnc1 |
| InChI | InChI=1S/C13H11ClN4/c1-9-16-11-4-5-12(14)17-13(11)18(9)8-10-3-2-6-15-7-10/h2-7H,8H2,1H3 |
| InChIKey | TUCPPZPKZBEZGV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|