C15H16N4O3S — CID 24929794
6-[(2-methoxy-5-nitrophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24929794) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 6-[(2-methoxy-5-nitrophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24929794 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCc2[nH]c(=S)ncc2C1 |
| InChI | InChI=1S/C15H16N4O3S/c1-22-14-3-2-12(19(20)21)6-10(14)8-18-5-4-13-11(9-18)7-16-15(23)17-13/h2-3,6-7H,4-5,8-9H2,1H3,(H,16,17,23) |
| InChIKey | MOTNINZGXODBRM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|