C18H16N4O3S — CID 24909841
6-[[5-(4-nitrophenyl)furan-2-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24909841) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 6-[[5-(4-nitrophenyl)furan-2-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[[5-(4-nitrophenyl)furan-2-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24909841 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 6-[[5-(4-nitrophenyl)furan-2-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CN3CCc4[nH]c(=S)ncc4C3)o2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c23-22(24)14-3-1-12(2-4-14)17-6-5-15(25-17)11-21-8-7-16-13(10-21)9-19-18(26)20-16/h1-6,9H,7-8,10-11H2,(H,19,20,26) |
| InChIKey | QNADNLVPNLDNMO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|