About cobalt(2+);bis(cyclopenta-1,3-diene)
cobalt(2+);bis(cyclopenta-1,3-diene) (PubChem CID 24942376) has the molecular formula C10H10Co
and a molecular weight of 189.12 g/mol. Its IUPAC name is cobalt(2+);bis(cyclopenta-1,3-diene).
Molecular Properties
| Compound Name | cobalt(2+);bis(cyclopenta-1,3-diene) |
| PubChem CID | 24942376 |
| Molecular Formula | C10H10Co |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | cobalt(2+);bis(cyclopenta-1,3-diene) |
| SMILES | [C-]1=CC=CC1.[C-]1=CC=CC1.[Co+2] |
| InChI | InChI=1S/2C5H5.Co/c2*1-2-4-5-3-1;/h2*1-3H,4H2;/q2*-1;+2 |
| InChIKey | SNBRJOIYNQIWSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(cyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(cyclopenta-1,3-diene)?
The IUPAC name of cobalt(2+);bis(cyclopenta-1,3-diene) (CID 24942376) is cobalt(2+);bis(cyclopenta-1,3-diene).
What is the SMILES notation for cobalt(2+);bis(cyclopenta-1,3-diene)?
The canonical SMILES for cobalt(2+);bis(cyclopenta-1,3-diene) is [C-]1=CC=CC1.[C-]1=CC=CC1.[Co+2].
What is the InChIKey of cobalt(2+);bis(cyclopenta-1,3-diene)?
The InChIKey is SNBRJOIYNQIWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Co/c2*1-2-4-5-3-1;/h2*1-3H,4H2;/q2*-1;+2.
What are the key properties of cobalt(2+);bis(cyclopenta-1,3-diene)?
cobalt(2+);bis(cyclopenta-1,3-diene) has a molecular weight of 189.12 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(cyclopenta-1,3-diene) is sourced from PubChem (CID 24942376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).