C32H41N3O4S — CID 24944983
1-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-[(1-naphthalen-1-ylsulfonylpiperidin-2-yl)methoxy]ethanone (PubChem CID 24944983) has the molecular formula C32H41N3O4S and a molecular weight of 563.76 g/mol. Its IUPAC name is 1-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-[(1-naphthalen-1-ylsulfonylpiperidin-2-yl)methoxy]ethanone.
| Compound Name | 1-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-[(1-naphthalen-1-ylsulfonylpiperidin-2-yl)methoxy]ethanone |
|---|---|
| PubChem CID | 24944983 |
| Molecular Formula | C32H41N3O4S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 1-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-[(1-naphthalen-1-ylsulfonylpiperidin-2-yl)methoxy]ethanone |
| SMILES | CN(C)c1ccc(C2CCCCCN2C(=O)COCC2CCCCN2S(=O)(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C32H41N3O4S/c1-33(2)27-19-17-26(18-20-27)30-15-4-3-8-21-34(30)32(36)24-39-23-28-13-7-9-22-35(28)40(37,38)31-16-10-12-25-11-5-6-14-29(25)31/h5-6,10-12,14,16-20,28,30H,3-4,7-9,13,15,21-24H2,1-2H3 |
| InChIKey | DTGSMACKHGRXFC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|