C32H41N3O4S — CID 68781056
2-[[2-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-oxoethoxy]-naphthalen-1-ylmethyl]piperidine-1-sulfinic acid (PubChem CID 68781056) has the molecular formula C32H41N3O4S and a molecular weight of 563.76 g/mol. Its IUPAC name is 2-[[2-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-oxoethoxy]-naphthalen-1-ylmethyl]piperidine-1-sulfinic acid.
| Compound Name | 2-[[2-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-oxoethoxy]-naphthalen-1-ylmethyl]piperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 68781056 |
| Molecular Formula | C32H41N3O4S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 2-[[2-[2-[4-(dimethylamino)phenyl]azepan-1-yl]-2-oxoethoxy]-naphthalen-1-ylmethyl]piperidine-1-sulfinic acid |
| SMILES | CN(C)c1ccc(C2CCCCCN2C(=O)COC(c2cccc3ccccc23)C2CCCCN2S(=O)O)cc1 |
| InChI | InChI=1S/C32H41N3O4S/c1-33(2)26-19-17-25(18-20-26)29-15-4-3-8-21-34(29)31(36)23-39-32(30-16-7-9-22-35(30)40(37)38)28-14-10-12-24-11-5-6-13-27(24)28/h5-6,10-14,17-20,29-30,32H,3-4,7-9,15-16,21-23H2,1-2H3,(H,37,38) |
| InChIKey | NWIIIXJFQXFJDM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|