C25H21NO3 — CID 24950220
3-[3-hydroxy-5-(6-hydroxynaphthalen-2-yl)phenyl]-N-phenylpropanamide (PubChem CID 24950220) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[3-hydroxy-5-(6-hydroxynaphthalen-2-yl)phenyl]-N-phenylpropanamide.
| Compound Name | 3-[3-hydroxy-5-(6-hydroxynaphthalen-2-yl)phenyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 24950220 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[3-hydroxy-5-(6-hydroxynaphthalen-2-yl)phenyl]-N-phenylpropanamide |
| SMILES | O=C(CCc1cc(O)cc(-c2ccc3cc(O)ccc3c2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C25H21NO3/c27-23-10-9-18-14-19(7-8-20(18)15-23)21-12-17(13-24(28)16-21)6-11-25(29)26-22-4-2-1-3-5-22/h1-5,7-10,12-16,27-28H,6,11H2,(H,26,29) |
| InChIKey | VWXMZUSJANGGMH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |