C21H17N3O3S — CID 24954552
6-amino-5-[2-(4-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide (PubChem CID 24954552) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is 6-amino-5-[2-(4-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-[2-(4-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24954552 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 6-amino-5-[2-(4-hydroxyphenyl)ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
| SMILES | C[S@@](=O)(=NC(=O)c1cnc(N)c(C#Cc2ccc(O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O3S/c1-28(27,19-5-3-2-4-6-19)24-21(26)17-13-16(20(22)23-14-17)10-7-15-8-11-18(25)12-9-15/h2-6,8-9,11-14,25H,1H3,(H2,22,23)/t28-/m0/s1 |
| InChIKey | TVGRIGFJKARLLQ-NDEPHWFRSA-N |
| XLogP | 3.07 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|