C24H20N2O5S — CID 24954917
ethyl 2-[N-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]acetate (PubChem CID 24954917) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is ethyl 2-[N-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]acetate.
| Compound Name | ethyl 2-[N-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]acetate |
|---|---|
| PubChem CID | 24954917 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | ethyl 2-[N-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]acetate |
| SMILES | CCOC(=O)C[S@@](=O)(=NC(=O)c1cncc(C#Cc2cccc(O)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O5S/c1-2-31-23(28)17-32(30,22-9-4-3-5-10-22)26-24(29)20-13-19(15-25-16-20)12-11-18-7-6-8-21(27)14-18/h3-10,13-16,27H,2,17H2,1H3/t32-/m0/s1 |
| InChIKey | OLORBUGPNKAMHH-YTTGMZPUSA-N |
| XLogP | 3.42 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|