C28H30FN3O2 — CID 24963846
(8R,9S,13S,14S,15R)-15-[2-[4-(2-fluorophenyl)triazol-1-yl]ethyl]-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 24963846) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-15-[2-[4-(2-fluorophenyl)triazol-1-yl]ethyl]-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-15-[2-[4-(2-fluorophenyl)triazol-1-yl]ethyl]-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 24963846 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (8R,9S,13S,14S,15R)-15-[2-[4-(2-fluorophenyl)triazol-1-yl]ethyl]-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@H](CCn1cc(-c3ccccc3F)nn1)CC2=O |
| InChI | InChI=1S/C28H30FN3O2/c1-28-12-10-21-20-9-7-19(33)14-17(20)6-8-22(21)27(28)18(15-26(28)34)11-13-32-16-25(30-31-32)23-4-2-3-5-24(23)29/h2-5,7,9,14,16,18,21-22,27,33H,6,8,10-13,15H2,1H3/t18-,21-,22-,27+,28-/m1/s1 |
| InChIKey | USJDCEPRFMVPTE-DIMCCBHJSA-N |
| XLogP | 5.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |