C28H39N3O2 — CID 24964924
(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-15-[3-[4-(3-methylbutyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 24964924) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-15-[3-[4-(3-methylbutyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-15-[3-[4-(3-methylbutyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 24964924 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | (8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-15-[3-[4-(3-methylbutyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)CCc1cn(CCC[C@@H]2CC(=O)[C@@]3(C)CC[C@@H]4c5ccc(O)cc5CC[C@H]4[C@H]23)nn1 |
| InChI | InChI=1S/C28H39N3O2/c1-18(2)6-8-21-17-31(30-29-21)14-4-5-20-16-26(33)28(3)13-12-24-23-11-9-22(32)15-19(23)7-10-25(24)27(20)28/h9,11,15,17-18,20,24-25,27,32H,4-8,10,12-14,16H2,1-3H3/t20-,24-,25-,27+,28-/m1/s1 |
| InChIKey | QADAISHMRZUOSR-KJNWGMDVSA-N |
| XLogP | 5.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |