C16H14FIN4O3 — CID 24965728
5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24965728) has the molecular formula C16H14FIN4O3 and a molecular weight of 456.22 g/mol. Its IUPAC name is 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24965728 |
| Molecular Formula | C16H14FIN4O3 |
| Molecular Weight | 456.22 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(I)cc2F)c2c(=O)n(CCO)cnc21 |
| InChI | InChI=1S/C16H14FIN4O3/c1-21-13(24)7-12(20-11-3-2-9(18)6-10(11)17)14-15(21)19-8-22(4-5-23)16(14)25/h2-3,6-8,20,23H,4-5H2,1H3 |
| InChIKey | BXWCMILXGIDJLA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|