C24H19F3N4O2 — CID 24968234
3-[5-[(dimethylamino)methyl]-2-(trifluoromethyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 24968234) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is 3-[5-[(dimethylamino)methyl]-2-(trifluoromethyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-[(dimethylamino)methyl]-2-(trifluoromethyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 24968234 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-[5-[(dimethylamino)methyl]-2-(trifluoromethyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)Cc1ccc2[nH]c(C(F)(F)F)c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-31(2)11-12-7-8-17-14(9-12)18(21(29-17)24(25,26)27)20-19(22(32)30-23(20)33)15-10-28-16-6-4-3-5-13(15)16/h3-10,28-29H,11H2,1-2H3,(H,30,32,33) |
| InChIKey | HPQVAXNBISQWOD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|