About 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one
3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one (PubChem CID 24968350) has the molecular formula C19H20Cl2N2O
and a molecular weight of 363.29 g/mol. Its IUPAC name is 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one |
| PubChem CID | 24968350 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one |
| SMILES | CC(C)C1CN(c2cc(Cl)ccc2Cl)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H20Cl2N2O/c1-13(2)18-12-23(17-10-15(20)8-9-16(17)21)19(24)22(18)11-14-6-4-3-5-7-14/h3-10,13,18H,11-12H2,1-2H3 |
| InChIKey | PFPAVXKLHRSKFP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one?
The IUPAC name of 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one (CID 24968350) is 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one.
What is the SMILES notation for 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one?
The canonical SMILES for 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one is CC(C)C1CN(c2cc(Cl)ccc2Cl)C(=O)N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one?
The InChIKey is PFPAVXKLHRSKFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O/c1-13(2)18-12-23(17-10-15(20)8-9-16(17)21)19(24)22(18)11-14-6-4-3-5-7-14/h3-10,13,18H,11-12H2,1-2H3.
What are the key properties of 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one?
3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one has a molecular weight of 363.29 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-(2,5-dichlorophenyl)-4-propan-2-ylimidazolidin-2-one is sourced from PubChem (CID 24968350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).