C10H11N3O2S2 — CID 24973844
(NZ)-N-(2-amino-1,3-thiazol-4-ylidene)-4-methylbenzenesulfonamide (PubChem CID 24973844) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is (NZ)-N-(2-amino-1,3-thiazol-4-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-(2-amino-1,3-thiazol-4-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24973844 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (NZ)-N-(2-amino-1,3-thiazol-4-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/CSC(N)=N2)cc1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-7-2-4-8(5-3-7)17(14,15)13-9-6-16-10(11)12-9/h2-5H,6H2,1H3,(H2,11,12,13) |
| InChIKey | WQMPVTFESZYFRV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|