C11H19NO4 — CID 24976325
methyl (Z)-4,4-dimethoxy-3-pyrrolidin-1-ylbut-2-enoate (PubChem CID 24976325) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl (Z)-4,4-dimethoxy-3-pyrrolidin-1-ylbut-2-enoate.
| Compound Name | methyl (Z)-4,4-dimethoxy-3-pyrrolidin-1-ylbut-2-enoate |
|---|---|
| PubChem CID | 24976325 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl (Z)-4,4-dimethoxy-3-pyrrolidin-1-ylbut-2-enoate |
| SMILES | COC(=O)/C=C(/C(OC)OC)N1CCCC1 |
| InChI | InChI=1S/C11H19NO4/c1-14-10(13)8-9(11(15-2)16-3)12-6-4-5-7-12/h8,11H,4-7H2,1-3H3/b9-8- |
| InChIKey | ZIDNMKMGRVRDSN-HJWRWDBZSA-N |
| XLogP | 0.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|