C17H32O2 — CID 24976366
(6E)-2-methyl-10,10-di(propan-2-yloxy)deca-2,6-diene (PubChem CID 24976366) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (6E)-2-methyl-10,10-di(propan-2-yloxy)deca-2,6-diene.
| Compound Name | (6E)-2-methyl-10,10-di(propan-2-yloxy)deca-2,6-diene |
|---|---|
| PubChem CID | 24976366 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (6E)-2-methyl-10,10-di(propan-2-yloxy)deca-2,6-diene |
| SMILES | CC(C)=CCC/C=C/CCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H32O2/c1-14(2)12-10-8-7-9-11-13-17(18-15(3)4)19-16(5)6/h7,9,12,15-17H,8,10-11,13H2,1-6H3/b9-7+ |
| InChIKey | RJWKPXYTKVFNIO-VQHVLOKHSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|