C22H22ClN3O2 — CID 24979696
1-(2-chlorophenyl)-3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 24979696) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24979696 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3Cl)cc2C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-15-8-10-16(11-9-15)21-18(22(27)24-13-17-5-4-12-28-17)14-26(25-21)20-7-3-2-6-19(20)23/h2-3,6-11,14,17H,4-5,12-13H2,1H3,(H,24,27) |
| InChIKey | MIMHPEFFVDEQOM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |