C37H39IN6O4S — CID 24983883
N-[4-[[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]methyl]-2-iodophenyl]-3-[4-[(2-phenylphenyl)carbamoylamino]piperidin-1-yl]propanamide (PubChem CID 24983883) has the molecular formula C37H39IN6O4S and a molecular weight of 790.73 g/mol. Its IUPAC name is N-[4-[[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]methyl]-2-iodophenyl]-3-[4-[(2-phenylphenyl)carbamoylamino]piperidin-1-yl]propanamide.
| Compound Name | N-[4-[[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]methyl]-2-iodophenyl]-3-[4-[(2-phenylphenyl)carbamoylamino]piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 24983883 |
| Molecular Formula | C37H39IN6O4S |
| Molecular Weight | 790.73 g/mol |
| Exact Mass | 790.18 |
| IUPAC Name | N-[4-[[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]methyl]-2-iodophenyl]-3-[4-[(2-phenylphenyl)carbamoylamino]piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCC(NC(=O)Nc2ccccc2-c2ccccc2)CC1)Nc1ccc(CNCCc2ccc(O)c3[nH]c(=O)sc23)cc1I |
| InChI | InChI=1S/C37H39IN6O4S/c38-29-22-24(23-39-18-14-26-11-13-32(45)34-35(26)49-37(48)43-34)10-12-31(29)41-33(46)17-21-44-19-15-27(16-20-44)40-36(47)42-30-9-5-4-8-28(30)25-6-2-1-3-7-25/h1-13,22,27,39,45H,14-21,23H2,(H,41,46)(H,43,48)(H2,40,42,47) |
| InChIKey | WYDBTKYNGTZNNB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|