C16H15F3N2O2 — CID 24984620
[5-cyano-4-(trifluoromethyl)indol-1-yl] 3,3-dimethylbutanoate (PubChem CID 24984620) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is [5-cyano-4-(trifluoromethyl)indol-1-yl] 3,3-dimethylbutanoate.
| Compound Name | [5-cyano-4-(trifluoromethyl)indol-1-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 24984620 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [5-cyano-4-(trifluoromethyl)indol-1-yl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)On1ccc2c(C(F)(F)F)c(C#N)ccc21 |
| InChI | InChI=1S/C16H15F3N2O2/c1-15(2,3)8-13(22)23-21-7-6-11-12(21)5-4-10(9-20)14(11)16(17,18)19/h4-7H,8H2,1-3H3 |
| InChIKey | QCMAWDKSQGKPRH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |