C14H13F3N2O — CID 67403809
1-(2-hydroxypropyl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile (PubChem CID 67403809) has the molecular formula C14H13F3N2O and a molecular weight of 282.27 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile.
| Compound Name | 1-(2-hydroxypropyl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 67403809 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(2-hydroxypropyl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile |
| SMILES | Cc1cc2c(C(F)(F)F)c(C#N)ccc2n1CC(C)O |
| InChI | InChI=1S/C14H13F3N2O/c1-8-5-11-12(19(8)7-9(2)20)4-3-10(6-18)13(11)14(15,16)17/h3-5,9,20H,7H2,1-2H3 |
| InChIKey | JDGXZGPCSUYFQS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |