C15H15F3N2S — CID 86709162
2-methyl-1-(1-methylsulfanylpropan-2-yl)-4-(trifluoromethyl)indole-5-carbonitrile (PubChem CID 86709162) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-methyl-1-(1-methylsulfanylpropan-2-yl)-4-(trifluoromethyl)indole-5-carbonitrile.
| Compound Name | 2-methyl-1-(1-methylsulfanylpropan-2-yl)-4-(trifluoromethyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 86709162 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-methyl-1-(1-methylsulfanylpropan-2-yl)-4-(trifluoromethyl)indole-5-carbonitrile |
| SMILES | CSCC(C)n1c(C)cc2c(C(F)(F)F)c(C#N)ccc21 |
| InChI | InChI=1S/C15H15F3N2S/c1-9-6-12-13(20(9)10(2)8-21-3)5-4-11(7-19)14(12)15(16,17)18/h4-6,10H,8H2,1-3H3 |
| InChIKey | RNBVAGFCAZYDFR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |