C16H17F3N2O — CID 86709160
1-(3-hydroxy-3-methylbutan-2-yl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile (PubChem CID 86709160) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methylbutan-2-yl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile.
| Compound Name | 1-(3-hydroxy-3-methylbutan-2-yl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 86709160 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(3-hydroxy-3-methylbutan-2-yl)-2-methyl-4-(trifluoromethyl)indole-5-carbonitrile |
| SMILES | Cc1cc2c(C(F)(F)F)c(C#N)ccc2n1C(C)C(C)(C)O |
| InChI | InChI=1S/C16H17F3N2O/c1-9-7-12-13(21(9)10(2)15(3,4)22)6-5-11(8-20)14(12)16(17,18)19/h5-7,10,22H,1-4H3 |
| InChIKey | CKLAMIYZRWFTEB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |