C24H31N2O6P — CID 24986208
4-diethoxyphosphoryl-N-methyl-N-[1-(3-nitrophenyl)-2-phenylmethoxyethyl]but-2-yn-1-amine (PubChem CID 24986208) has the molecular formula C24H31N2O6P and a molecular weight of 474.49 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-N-methyl-N-[1-(3-nitrophenyl)-2-phenylmethoxyethyl]but-2-yn-1-amine.
| Compound Name | 4-diethoxyphosphoryl-N-methyl-N-[1-(3-nitrophenyl)-2-phenylmethoxyethyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 24986208 |
| Molecular Formula | C24H31N2O6P |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 4-diethoxyphosphoryl-N-methyl-N-[1-(3-nitrophenyl)-2-phenylmethoxyethyl]but-2-yn-1-amine |
| SMILES | CCOP(=O)(CC#CCN(C)C(COCc1ccccc1)c1cccc([N+](=O)[O-])c1)OCC |
| InChI | InChI=1S/C24H31N2O6P/c1-4-31-33(29,32-5-2)17-10-9-16-25(3)24(20-30-19-21-12-7-6-8-13-21)22-14-11-15-23(18-22)26(27)28/h6-8,11-15,18,24H,4-5,16-17,19-20H2,1-3H3 |
| InChIKey | RDWIVNLCCPZDOF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|