C16H21NO3 — CID 24987636
ethyl 3-(4-methoxyphenyl)-3-[methyl(prop-2-ynyl)amino]propanoate (PubChem CID 24987636) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 3-(4-methoxyphenyl)-3-[methyl(prop-2-ynyl)amino]propanoate.
| Compound Name | ethyl 3-(4-methoxyphenyl)-3-[methyl(prop-2-ynyl)amino]propanoate |
|---|---|
| PubChem CID | 24987636 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethyl 3-(4-methoxyphenyl)-3-[methyl(prop-2-ynyl)amino]propanoate |
| SMILES | C#CCN(C)C(CC(=O)OCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-5-11-17(3)15(12-16(18)20-6-2)13-7-9-14(19-4)10-8-13/h1,7-10,15H,6,11-12H2,2-4H3 |
| InChIKey | VNEIBDLDMJIZQM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|