C28H26N4O5S — CID 24988195
4-[(2-benzoylphenyl)sulfamoyl]-N-[2-(4-cyanopiperidin-1-yl)-2-oxoethyl]benzamide (PubChem CID 24988195) has the molecular formula C28H26N4O5S and a molecular weight of 530.61 g/mol. Its IUPAC name is 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-(4-cyanopiperidin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-(4-cyanopiperidin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24988195 |
| Molecular Formula | C28H26N4O5S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-(4-cyanopiperidin-1-yl)-2-oxoethyl]benzamide |
| SMILES | N#CC1CCN(C(=O)CNC(=O)c2ccc(S(=O)(=O)Nc3ccccc3C(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H26N4O5S/c29-18-20-14-16-32(17-15-20)26(33)19-30-28(35)22-10-12-23(13-11-22)38(36,37)31-25-9-5-4-8-24(25)27(34)21-6-2-1-3-7-21/h1-13,20,31H,14-17,19H2,(H,30,35) |
| InChIKey | XFANWVDGBSDVIG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|