C29H31N3O6S — CID 24988556
4-[(2-benzoylphenyl)sulfamoyl]-N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 24988556) has the molecular formula C29H31N3O6S and a molecular weight of 549.65 g/mol. Its IUPAC name is 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24988556 |
| Molecular Formula | C29H31N3O6S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 4-[(2-benzoylphenyl)sulfamoyl]-N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCC(CCO)CC1)c1ccc(S(=O)(=O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31N3O6S/c33-19-16-21-14-17-32(18-15-21)27(34)20-30-29(36)23-10-12-24(13-11-23)39(37,38)31-26-9-5-4-8-25(26)28(35)22-6-2-1-3-7-22/h1-13,21,31,33H,14-20H2,(H,30,36) |
| InChIKey | OGVLIWUTVQVBEN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|